SKI Calculus: Difference between revisions
Linked Brainfuck |
|||
| Line 177: | Line 177: | ||
== See Also == | == See Also == | ||
[https://web.archive.org/web/20250217071017/https://komiamiko.me/math/ordinals/2020/06/21/ski-numerals.html Lower bounds of this function] (archived) | * [https://web.archive.org/web/20250217071017/https://komiamiko.me/math/ordinals/2020/06/21/ski-numerals.html Lower bounds of this function] (archived) | ||
* [https://dallaylaen.github.io/ski-interpreter/ SKI interpreter] | |||
[https://dallaylaen.github.io/ski-interpreter/ SKI interpreter] | * [[Brainfuck]] | ||
[[Category:Functions]] | [[Category:Functions]] | ||
Revision as of 19:44, 22 May 2026
A SKI calculus program is a binary tree where the leaves are combinators, the three symbols S, K, I. Using parentheses to notate the tree, a simple example of a SKI program is (((SK)S)((KI)S)). We can omit parentheses by assuming they are left-binding by default, so we simplify our program to SKS(KIS).
Like lambda calculus, SKI calculus has a process called beta-reduction. We change the tree according to any reducible redex.
Ix -> x Kfx -> f Sfgx -> fx(gx)
Note that xyz represent any valid trees, not just single combinators. We repeat this process and we say it terminates if the combinator cannot be beta-reduced.
Busy Beaver for SKI calculus (BB_SKI) is a variation of the Busy Beaver problem for lambda calculus. BB_SKI(n) is defined as the size of the largest output of a terminating program of size n.
Champions
| n | Value | Champion | Discovered by |
|---|---|---|---|
| 1 | = 1 | S | |
| 2 | = 2 | SS | |
| 3 | = 3 | SSS | |
| 4 | = 4 | SSSS | |
| 5 | = 6 | SSS(SS) | |
| 6 | = 17 | SSS(SI)S | |
| 7 | ≥ 40 | S(SS)S(SS)S | |
| 8 | ≥ 41 | SII(S(S(SS)))S | |
| 9 | ≥ 79 | SII(SS(SSS))S | |
| 10 | ≥ 164 | SII(SS(SS(SS)))S | |
| 11 | ≥ 681 | SII(SS(SS(SSS)))S | |
| 12 | ≥ 196606 | S(S(SI))I(S(S(KS)K)I)K | |
| 13 | > 2^2^2^21 | S(S(SSS)I)I(S(S(KS)K)I) | |
| 14 | > 2^^18 | S(S(S(SSS))I)I(S(S(KS)K)I) | |
| 15 | > 2^^2^128 | SSK(S(S(KS)K)I)(S(SSSI)I) | |
| 16 | > 2^^2^2^2^2^21 | SSK(S(S(KS)K)I)(S(S(SSS)I)I) | |
| 17 | > 2^^^2^128 | S(SSK(S(SSSI)I))I(S(S(KS)K)I) | |
| 18 | > 2{65535}4 | S(S(SI))I(S(K(S(SI(K(S(S(KS)K)I)))))K) | |
| 19 | > 2{65535}4 | S(S(S(SI)))I(S(K(S(SI(K(S(S(KS)K)I)))))K) | |
| 20 | > Graham's Number | S(S(S(SI)))I(S(K(S(SS(K(K(S(S(KS)K)I))))))K) |
SK calculus
We can remove the I combinator and replace it by (SKS), (SKK) or any (SKx). These terms have a straightforward binary encoding where (prefix) application is 1, K=00, and S=01. Since n combinators take n-1 applications to combine, their code length is 2n + n-1 = 3n-1 bits.
Champions
| n | bits | Value | Champion | Discovered by |
|---|---|---|---|---|
| 1 | 2 | = 1 | S | |
| 2 | 5 | = 2 | SS | |
| 3 | 8 | = 3 | SSS | |
| 4 | 11 | = 4 | SSSS | |
| 5 | 14 | = 6 | SSS(SS) | |
| 6 | 17 | = 10 | SSS(SS)S | |
| 7 | 20 | ≥ 40 | S(SS)S(SS)S | |
| 8 | 23 | ≥ 41 | S(S(SS)S(SS)S) | |
| 9 | 26 | ≥ 42 | S(S(S(SS)S(SS)S)) | |
| 10 | 29 | ≥ 66 | SS(SSS)(SS(SS))S | |
| 11 | 32 | ≥ 79 | SS(SSS)(SS(SSS))S | |
| 12 | 35 | ≥ 164 | SS(SKK)(SS)(SS(SS))S | |
| 13 | 38 | ≥ 681 | SS(SKK)(SS)(SS(SSS))S | |
| 14 | 41 | ≥ 1530 | SS(SKK)(SS)(SS(SS(SS)))S | |
| 15 | 44 | ≥ 7811 | SS(SKK)(SS)(SS(SS(SSS)))S |
Oracles
We can extend BB_SKI with oracles, making it stronger than BB. For example, we can add an oracle combinator O where Ofxy=x iff for all z fz=z, and y otherwise. The resulting busy beaver, known as the Xi function, is estimated to be faster-growing than ordinal oracle busy beavers with the oracle degree <= w_1^CK. A further extension would be to add another oracle, O’, where O’fxy=x iff f is well-founded, and y otherwise, where a term is well-founded iff there is no infinitely nested outermost-redex oracle calls. The resulting busy beaver is called Xi_2.