SKI Calculus: Difference between revisions
m →Oracles: removed misinformation; "Ξ 7 champion" is wrong, so "Ξ 8" is probably too |
|||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 272: | Line 272: | ||
== Oracles == | == Oracles == | ||
We can extend Ξ₀ with oracles, making it stronger than BB. For example, we can add an oracle combinator O where Ofxy=x iff for all z fz is equivalent to z, and y otherwise. The resulting busy beaver, known as the Ξ function, is estimated to be faster-growing than oracle busy beavers with the oracle degree ≤ ω₁<sup>CK</sup>. A further extension would be to add another oracle, O’, where O’fxy=x iff f is well-founded, and y otherwise, where a term is well-founded iff there is no infinitely nested outermost-redex oracle calls. The resulting busy beaver is called Ξ₂. | We can extend Ξ₀ with oracles, making it stronger than BB. For example, we can add an oracle combinator O where Ofxy=x iff for all z fz is equivalent to z, and y otherwise. The resulting busy beaver, known as the Ξ function, is estimated to be faster-growing than oracle busy beavers with the oracle degree ≤ ω₁<sup>CK</sup>. In addition, Ξ is independent of True Arithmetic, requiring Δ¹₁ truth to fully decide. A further extension would be to add another oracle, O’, where O’fxy=x iff f is well-founded, and y otherwise, where a term is well-founded iff there is no infinitely nested outermost-redex oracle calls. The resulting busy beaver is called Ξ₂. | ||
=== Champions for Ξ<sub>SKIO</sub> === | === Champions for Ξ<sub>SKIO</sub> === | ||
Latest revision as of 01:07, 24 September 2026
A SKI calculus program is a binary tree where the leaves are combinators, the three symbols S, K, I. Using parentheses to notate the tree, a simple example of a SKI program is (((SK)S)((KI)S)). We can omit parentheses by assuming they are left-binding by default, so we simplify our program to SKS(KIS).
Like lambda calculus, SKI calculus has a process called beta-reduction. We change the tree according to any reducible redex.
Sfgx => fx(gx)
Kfx => f
Ix => x
Note that xyz represent any valid trees, not just single combinators. We repeat this process and we say it terminates if the combinator cannot be beta-reduced.
Busy Beaver for SKI calculus (Ξ₀) is a variation of the Busy Beaver problem for lambda calculus. Ξ₀(n) is defined as the size of the largest output of a terminating program of size n.
Champions
| n | Value | Champion |
|---|---|---|
| 1 | = 1 | S |
| 2 | = 2 | SS |
| 3 | = 3 | SSS |
| 4 | = 4 | SSSS |
| 5 | = 6 | SSS(SS) |
| 6 | = 17 | SSS(SI)S |
| 7 | ≥ 41 | SSS(S(SS))S |
| 8 | ≥ 80 | SSK(S(SS)S)S |
| 9 | ≥ 169 | S(SS)(SS)(SS)SS |
| 10 | ≥ 376 | S(S(SS(KK)))(SS)(SS) |
| 11 | ≥ 912 | S(SS)S(SS)(S(S(KS))S) |
| 12 | ≥ 2^2^513*8-2 | S(SI)(SSK)(S(S(KS)K)I) |
| 13 | > 2^^2^^2^258 | SI(SI)(SSK)(S(S(KS)K)I) |
| 14 | > 2^^2^^2^258 | SI(SI)(SSK)(S(S(KS)K)I)S |
| 15 | > 2^^2^^2^^34 | S(S(SI)I(SSK))I(S(S(KS)K)I) |
| 16 | > 2^^^19 | S(S(SI))I(S(SSK)(K(S(S(KS)K)I))) |
| 17 | > 2^^^^2^^2^^258 | S(SS(SSS)I(SSK))I(S(S(KS)K)I) |
| 18 | > 2^^^^2^^2^^258 | S(SS(SSS)I(SSK))I(S(S(KS)K)I)S |
| 19 | > 2^^^^2^^^19 | SSI(SSK(S(S(KS)K)I))(S(K(S(SSK)))K) |
| 20 | > fω+1 (2^^7/2-1) > Graham's number | S(S(S(SI)))I(S(K(S(SS(K(K(S(S(KS)K)I))))))K) |
| ... | ||
| 27 | > fω+2 (2^2^21) | SI(SI(SI(S(S(K(SS(KI))))I)))(S(K(S(SSK)))K)(S(S(KS)K)I) |
| 28 | > fω+2 (2^2^21) | S(SI(SI(SI(S(S(K(SS(KI))))I)))(S(K(S(SSK)))K)(S(S(KS)K)I)) |
| 29 | > fω+3 (2^2^21) | SI(SI(SI(SI(S(S(K(SS(KI))))I))))(S(K(S(SSK)))K)(S(S(KS)K)I) |
| 30 | > fω+3 (2^2^21) | S(SI(SI(SI(SI(S(S(K(SS(KI))))I))))(S(K(S(SSK)))K)(S(S(KS)K)I)) |
| 31 | > fω+4 (2^2^21) | SI(SI(SI(SI(SI(S(S(K(SS(KI))))I)))))(S(K(S(SSK)))K)(S(S(KS)K)I) |
| 32 | > fω+4 (2^2^21) | S(SI(SI(SI(SI(SI(S(S(K(SS(KI))))I)))))(S(K(S(SSK)))K)(S(S(KS)K)I)) |
| ... |
SK calculus
We can remove the I combinator and replace it by (SKS), (SKK) or any (SKx). These terms have a straightforward binary encoding where (prefix) application is 1, K=00, and S=01. Since n combinators take n-1 applications to combine, their code length is 2n + n-1 = 3n-1 bits.
Champions for Ξ₀SK
| n | bits | Value | Champion |
|---|---|---|---|
| 1 | 2 | = 1 | S |
| 2 | 5 | = 2 | SS |
| 3 | 8 | = 3 | SSS |
| 4 | 11 | = 4 | SSSS |
| 5 | 14 | = 6 | SSS(SS) |
| 6 | 17 | = 10 | SSS(SS)S |
| 7 | 20 | ≥ 41 | SSS(S(SS))S |
| 8 | 23 | ≥ 80 | SSK(S(SS)S)S |
| 9 | 26 | ≥ 169 | S(SS)(SS)(SS)SS |
| 10 | 29 | ≥ 376 | S(S(SS(KK)))(SS)(SS) |
| 11 | 32 | ≥ 912 | S(SS)S(SS)(S(S(KS))S) |
| 12 | 35 | ≥ 1530 | S(SS)(SS)(SS(SS(SS)))S |
| 13 | 38 | ≥ 7811 | S(SS)(SS)(SS(SS(SSS)))S |
| 14 | 41 | ≥ 2^2097156*13-2 | SSS(SSK)(SS(SK)(S(KS)K)) |
| 15 | 44 | ≥ 2^2^2097156*3-2 | SSS(SSK)(SS(SK)(S(KS)K))S |
| 16 | 47 | > 2^2^2^8193 | S(SS(SS))(SSK)(SS(SK)(S(KS)K)) |
| 17 | 50 | > 2^^2^^2^258 | SSS(SKS)(SSK)(SS(SK)(S(KS)K)) |
| ... | |||
| 22 | 65 | > 2^^^19 | S(S(S(S(SK))))(SKS)(S(SSK)(K(SS(SK)(S(KS)K))) |
| 23 | 68 | > 2^^^^2^^^19 | SS(S(SK))(SSK(SS(SK)(S(KS)K)))(S(K(S(SSK)))K) |
| 24 | 71 | > 2^^^^2^^^19 | S(SS(S(SK))(SSK(SS(SK)(S(KS)K)))(S(K(S(SSK)))K)) |
| 25 | 74 | > 3{7}3 | SS(S(SK))(SSK(SS(SS(SK))(S(KS)K)))(S(K(S(SSK)))K) |
| 26 | 77 | > fω+1(2^^7/2-1) > Graham's number | S(S(S(S(SKS))))(SKS)(S(K(S(SS(K(K(SS(SK)(S(KS)K)))))))K) |
TODO: Champions analysis.
BCKW system
BCKW system is a variation of SK calculus that replace the S combinator by 3 new combinators B, C and W.
Bfgx => f(gx)
Cfxy => fyx
Kfx => f
Wfx => fxx
Champions for Ξ₀BCKW
| n | Value | Champion |
|---|---|---|
| 1 | = 1 | B |
| 2 | = 2 | BB |
| 3 | = 3 | BBB |
| 4 | ≥ 11 | WW(WB) |
| 5 | ≥ 47 | W(WW)(WB) |
| 6 | ≥ 2^256*6-1 | WW(WC(WB)) |
| 7 | > 2^^^17 | WW(C(WC)(WB)) |
| 8 | > 2^^^2^^^17 | W(WW)(C(WC)(WB)) |
| 9 | > 2{5}2^^^^2^^^19 | WW(WB(C(WC))(WB)) |
| 10 | > fω+1(2^^6/2-1) | WW(C(WB)(C(CC(WB)))) |
Oracles
We can extend Ξ₀ with oracles, making it stronger than BB. For example, we can add an oracle combinator O where Ofxy=x iff for all z fz is equivalent to z, and y otherwise. The resulting busy beaver, known as the Ξ function, is estimated to be faster-growing than oracle busy beavers with the oracle degree ≤ ω₁CK. In addition, Ξ is independent of True Arithmetic, requiring Δ¹₁ truth to fully decide. A further extension would be to add another oracle, O’, where O’fxy=x iff f is well-founded, and y otherwise, where a term is well-founded iff there is no infinitely nested outermost-redex oracle calls. The resulting busy beaver is called Ξ₂.
Champions for ΞSKIO
| n | Value | Champion |
|---|---|---|
| 1 | = 1 | S |
| 2 | = 2 | SS |
| 3 | = 3 | SSS |
| 4 | = 4 | SSSS |
| 5 | = 6 | SSS(SS) |
| 6 | = 17 | SSS(SI)S |
See Also
- Lower bounds of this function (archived)
- SKI interpreter