SKI Calculus: Difference between revisions
Remove suspicious link to missing resource. |
m link LC |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
A '''SKI calculus''' program is a binary tree where the leaves are combinators, the three symbols <code>S</code>, <code>K</code>, <code>I</code>. Using parentheses to notate the tree, a simple example of a SKI program is <code>(((SK)S)((KI)S))</code>. We can omit parentheses by assuming they are left-binding by default, so we simplify our program to <code>SKS(KIS)</code>. | A '''SKI calculus''' program is a binary tree where the leaves are combinators, the three symbols <code>S</code>, <code>K</code>, <code>I</code>. Using parentheses to notate the tree, a simple example of a SKI program is <code>(((SK)S)((KI)S))</code>. We can omit parentheses by assuming they are left-binding by default, so we simplify our program to <code>SKS(KIS)</code>. | ||
Like lambda calculus, SKI calculus has a process called beta-reduction. We change the tree according to any reducible redex. | Like [[Lambda Calculus|lambda calculus]], SKI calculus has a process called beta-reduction. We change the tree according to any reducible redex. | ||
* <code>Ix -> I</code> | * <code>Ix -> I</code> | ||
| Line 183: | Line 183: | ||
== See Also == | == See Also == | ||
[https://web.archive.org/web/20250217071017/https://komiamiko.me/math/ordinals/2020/06/21/ski-numerals.html Lower bounds of this function] (archived) | |||
[https://dallaylaen.github.io/ski-interpreter/ SKI interpreter] | [https://dallaylaen.github.io/ski-interpreter/ SKI interpreter] | ||
[[Category:Functions]] | [[Category:Functions]] | ||
Latest revision as of 01:42, 11 May 2026
A SKI calculus program is a binary tree where the leaves are combinators, the three symbols S, K, I. Using parentheses to notate the tree, a simple example of a SKI program is (((SK)S)((KI)S)). We can omit parentheses by assuming they are left-binding by default, so we simplify our program to SKS(KIS).
Like lambda calculus, SKI calculus has a process called beta-reduction. We change the tree according to any reducible redex.
Ix -> IKxy -> KxSxyz -> Sxz(yz)
Note that xyz represent any valid trees, not just single combinators. We repeat this process and we say it terminates if the combinator cannot be beta-reduced.
Busy Beaver for SKI calculus (BB_SKI) is a variation of the Busy Beaver problem for lambda calculus. BB_SKI(n) is defined as the size of the largest output of a terminating program of size n.
Champions
| n | Value | Champion | Discoverered by |
|---|---|---|---|
| 1 | = 1 | S | ? |
| 2 | = 2 | SS | ? |
| 3 | = 3 | SSS | ? |
| 4 | = 4 | SSSS | ? |
| 5 | = 6 | SSS(SS) | ? |
| 6 | ≥ 17 | SSS(SI)S | ? |
| 7 | ≥ 40 | S(SS)S(SS)S | ? |
| 8 | ≥ 41 | SII(S(S(SS)))S | ? |
| 9 | ≥ 79 | SII(SS(SSS))S | ? |
| 10 | ≥ 164 | SII(SS(SS(SS)))S | ? |
| 11 | ≥ 681 | SII(SS(SS(SSS)))S | ? |
| 12 | ≥ 1530 | SII(SS(SS(SS(SS))))S | ? |
| 13 | ≥ 65537 | S(S(SI))I(S(S(KS)K)I)KK | ? |
| 14 | ≥ 2^256+1 | S(S(S(SI)))I(S(S(KS)K)I)KK | ? |
| 15 | > 2^2^2^2^21 | S(S(SSS)I)I(S(S(KS)K)I)KK | ? |
| 16 | > 2^^19 | S(S(S(SSS))I)I(S(S(KS)K)I)KK | ? |
| 17 | > 2^^2^128 | SSK(S(S(KS)K)I)(S(SI(SI))I)KK | ? |
| 18 | > 2^^2^2^2^2^21 | SSK(S(S(KS)K)I)(S(S(SSS)I)I)KK | ? |
| 19 | > 2^^^2^128 | S(SSK(S(SI(SI))I))I(S(S(KS)K)I)KK | ? |
| 20 | > 2^^^2^2^2^2^21 | S(SSK(S(S(SSS)I)I))I(S(S(KS)K)I)KK | ? |
| 21 | > 2^^^2^^19 | S(SSK(S(S(S(SSS))I)I))I(S(S(KS)K)I)KK | ? |
| 25 | > Graham's Number | SII(SI(SI(K(S(K(S(K(SS(K(K(S(S(KS)K)I)))))(SI)))K)))) | 2014MELO03 |
SK calculus
We can remove the I combinator and replace it by (SKS), (SKK) or any (SKx). These terms have a straightforward binary encoding where (prefix) application is 1, K=00, and S=01. Since n combinators take n-1 applications to combine, their code length is 2n + n-1 = 3n-1 bits.
Champions
| n | bits | Value | Champion | Discoverered by |
|---|---|---|---|---|
| 1 | 2 | = 1 | S | ? |
| 2 | 5 | = 2 | SS | ? |
| 3 | 8 | = 3 | SSS | ? |
| 4 | 11 | = 4 | SSSS | ? |
| 5 | 14 | = 6 | SSS(SS) | ? |
| 6 | 17 | ≥ 10 | SSS(SS)S | ? |
| 7 | 20 | ≥ 40 | S(SS)S(SS)S | ? |
| 8 | 23 | ≥ 41 | S(S(SS)S(SS)S) | ? |
| 9 | 26 | ≥ 42 | S(S(S(SS)S(SS)S)) | ? |
| 10 | 29 | ≥ 66 | SS(SSS)(SS(SS))S | ? |
| 11 | 32 | ≥ 79 | SS(SSS)(SS(SSS))S | ? |
| 12 | 35 | ≥ 164 | SS(SKK)(SS)(SS(SS))S | ? |
| 13 | 38 | ≥ 681 | SS(SKK)(SS)(SS(SSS))S | ? |
| 14 | 41 | ≥ 1530 | SS(SKK)(SS)(SS(SS(SS)))S | ? |
| 15 | 44 | ≥ 7811 | SS(SKK)(SS)(SS(SS(SSS)))S | ? |
See Also
Lower bounds of this function (archived)